C19H25NO — CID 91604645
(8R,9R,10S,13S,14S)-3-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-one (PubChem CID 91604645) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-3-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9R,10S,13S,14S)-3-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 91604645 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (8R,9R,10S,13S,14S)-3-imino-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-one |
| SMILES | [H]/N=C1\C=C[C@@]2(C)C(C=C[C@@H]3[C@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C19H25NO/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,12,14-16,20H,5-6,8,10-11H2,1-2H3/b20-13+/t12?,14-,15-,16+,18-,19-/m0/s1 |
| InChIKey | BSKIKYCZAOWOJV-DMOKNVEMSA-N |
| XLogP | 4.17 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|