About ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde
ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 91604958) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 91604958 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CC.O=CC1C=CC=CC1O |
| InChI | InChI=1S/C7H8O2.C2H6/c8-5-6-3-1-2-4-7(6)9;1-2/h1-7,9H;1-2H3 |
| InChIKey | UDBRWEVRRYGJAD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde (CID 91604958) is ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde is CC.O=CC1C=CC=CC1O.
What is the InChIKey of ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is UDBRWEVRRYGJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C2H6/c8-5-6-3-1-2-4-7(6)9;1-2/h1-7,9H;1-2H3.
What are the key properties of ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde?
ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 154.21 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-hydroxycyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 91604958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).