C24H33NO5S — CID 91605133
N-[2-cyclopentyl-1-(3-hydroxyphenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide;methanesulfonic acid (PubChem CID 91605133) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[2-cyclopentyl-1-(3-hydroxyphenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide;methanesulfonic acid.
| Compound Name | N-[2-cyclopentyl-1-(3-hydroxyphenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 91605133 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[2-cyclopentyl-1-(3-hydroxyphenyl)ethyl]-N-methyl-2-(4-methylphenyl)acetamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1ccc(CC(=O)N(C)C(CC2CCCC2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C23H29NO2.CH4O3S/c1-17-10-12-19(13-11-17)15-23(26)24(2)22(14-18-6-3-4-7-18)20-8-5-9-21(25)16-20;1-5(2,3)4/h5,8-13,16,18,22,25H,3-4,6-7,14-15H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | WBZLKTIYPQDQSD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|