About [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate
[2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate (PubChem CID 91606020) has the molecular formula C12H17NO5
and a molecular weight of 255.27 g/mol. Its IUPAC name is [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate.
Molecular Properties
| Compound Name | [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate |
| PubChem CID | 91606020 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)n([C@H]2CCCC[C@H]2O)c1O |
| InChI | InChI=1S/C12H17NO5/c1-7(14)18-10-6-11(16)13(12(10)17)8-4-2-3-5-9(8)15/h6,8-9,15-17H,2-5H2,1H3/t8-,9+/m0/s1 |
| InChIKey | HWLHHHSKEUFHEJ-DTWKUNHWSA-N |
| XLogP | 1.30 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate?
The IUPAC name of [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate (CID 91606020) is [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate.
What is the SMILES notation for [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate?
The canonical SMILES for [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate is CC(=O)Oc1cc(O)n([C@H]2CCCC[C@H]2O)c1O.
What is the InChIKey of [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate?
The InChIKey is HWLHHHSKEUFHEJ-DTWKUNHWSA-N. The full InChI is InChI=1S/C12H17NO5/c1-7(14)18-10-6-11(16)13(12(10)17)8-4-2-3-5-9(8)15/h6,8-9,15-17H,2-5H2,1H3/t8-,9+/m0/s1.
What are the key properties of [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate?
[2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate has a molecular weight of 255.27 g/mol, XLogP of 1.30, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dihydroxy-1-[(1S,2R)-2-hydroxycyclohexyl]pyrrol-3-yl] acetate is sourced from PubChem (CID 91606020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).