C26H26N10O3S — CID 91606086
N-hydroxy-2-[3-iminopropyl-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide (PubChem CID 91606086) has the molecular formula C26H26N10O3S and a molecular weight of 558.63 g/mol. Its IUPAC name is N-hydroxy-2-[3-iminopropyl-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[3-iminopropyl-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91606086 |
| Molecular Formula | C26H26N10O3S |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | N-hydroxy-2-[3-iminopropyl-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide |
| SMILES | [H]/N=C/CCN(Cc1cc2nc(-c3cccc4[nH]ncc34)nc(N3CCOCC3)c2s1)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C26H26N10O3S/c27-5-2-6-36(26-28-12-16(13-29-26)25(37)34-38)15-17-11-21-22(40-17)24(35-7-9-39-10-8-35)32-23(31-21)18-3-1-4-20-19(18)14-30-33-20/h1,3-5,11-14,27,38H,2,6-10,15H2,(H,30,33)(H,34,37)/b27-5+ |
| InChIKey | VLINBFAGUSANCL-FZXKJZBHSA-N |
| XLogP | 3.03 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|