C2HFO7S2 — CID 91606351
3-fluoro-2-hydroxy-2,4,4-trioxo-1,5-dioxa-2λ6,4λ6-dithiacyclohex-2-en-6-one (PubChem CID 91606351) has the molecular formula C2HFO7S2 and a molecular weight of 220.15 g/mol. Its IUPAC name is 3-fluoro-2-hydroxy-2,4,4-trioxo-1,5-dioxa-2λ6,4λ6-dithiacyclohex-2-en-6-one.
| Compound Name | 3-fluoro-2-hydroxy-2,4,4-trioxo-1,5-dioxa-2λ6,4λ6-dithiacyclohex-2-en-6-one |
|---|---|
| PubChem CID | 91606351 |
| Molecular Formula | C2HFO7S2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 219.91 |
| IUPAC Name | 3-fluoro-2-hydroxy-2,4,4-trioxo-1,5-dioxa-2λ6,4λ6-dithiacyclohex-2-en-6-one |
| SMILES | O=C1OS(=O)(=O)C(F)=S(=O)(O)O1 |
| InChI | InChI=1S/C2HFO7S2/c3-1-11(5,6)9-2(4)10-12(1,7)8/h(H,5,6) |
| InChIKey | WVRAEPAZGJWKJB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|