About 5-methyl-2,4-dioxopyrimidine-1-carboximidamide
5-methyl-2,4-dioxopyrimidine-1-carboximidamide (PubChem CID 91606483) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is 5-methyl-2,4-dioxopyrimidine-1-carboximidamide.
Molecular Properties
| Compound Name | 5-methyl-2,4-dioxopyrimidine-1-carboximidamide |
| PubChem CID | 91606483 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 5-methyl-2,4-dioxopyrimidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H8N4O2/c1-3-2-10(5(7)8)6(12)9-4(3)11/h2H,1H3,(H3,7,8)(H,9,11,12) |
| InChIKey | RBJQYCYDWSYGEY-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2,4-dioxopyrimidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,4-dioxopyrimidine-1-carboximidamide?
The IUPAC name of 5-methyl-2,4-dioxopyrimidine-1-carboximidamide (CID 91606483) is 5-methyl-2,4-dioxopyrimidine-1-carboximidamide.
What is the SMILES notation for 5-methyl-2,4-dioxopyrimidine-1-carboximidamide?
The canonical SMILES for 5-methyl-2,4-dioxopyrimidine-1-carboximidamide is [H]/N=C(\N)n1cc(C)c(=O)[nH]c1=O.
What is the InChIKey of 5-methyl-2,4-dioxopyrimidine-1-carboximidamide?
The InChIKey is RBJQYCYDWSYGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c1-3-2-10(5(7)8)6(12)9-4(3)11/h2H,1H3,(H3,7,8)(H,9,11,12).
What are the key properties of 5-methyl-2,4-dioxopyrimidine-1-carboximidamide?
5-methyl-2,4-dioxopyrimidine-1-carboximidamide has a molecular weight of 168.16 g/mol, XLogP of -1.41, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,4-dioxopyrimidine-1-carboximidamide is sourced from PubChem (CID 91606483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).