C19H19N3O8S2 — CID 91606624
(6R,7R)-3-(furan-2-carbonylsulfanylmethyl)-7-[[(2E)-2-methoxyimino-3-oxopentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 91606624) has the molecular formula C19H19N3O8S2 and a molecular weight of 481.51 g/mol. Its IUPAC name is (6R,7R)-3-(furan-2-carbonylsulfanylmethyl)-7-[[(2E)-2-methoxyimino-3-oxopentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(furan-2-carbonylsulfanylmethyl)-7-[[(2E)-2-methoxyimino-3-oxopentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 91606624 |
| Molecular Formula | C19H19N3O8S2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | (6R,7R)-3-(furan-2-carbonylsulfanylmethyl)-7-[[(2E)-2-methoxyimino-3-oxopentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCC(=O)/C(=N\OC)C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSC(=O)c3ccco3)CS[C@H]12 |
| InChI | InChI=1S/C19H19N3O8S2/c1-3-10(23)12(21-29-2)15(24)20-13-16(25)22-14(18(26)27)9(7-31-17(13)22)8-32-19(28)11-5-4-6-30-11/h4-6,13,17H,3,7-8H2,1-2H3,(H,20,24)(H,26,27)/b21-12+/t13-,17-/m1/s1 |
| InChIKey | YZESIECQUWYUJH-URRPQFMESA-N |
| XLogP | 0.87 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|