About 4-ethyl-1,3-dimethyl-2H-triazole
4-ethyl-1,3-dimethyl-2H-triazole (PubChem CID 91607569) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 4-ethyl-1,3-dimethyl-2H-triazole.
Molecular Properties
| Compound Name | 4-ethyl-1,3-dimethyl-2H-triazole |
| PubChem CID | 91607569 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 4-ethyl-1,3-dimethyl-2H-triazole |
| SMILES | CCC1=CN(C)NN1C |
| InChI | InChI=1S/C6H13N3/c1-4-6-5-8(2)7-9(6)3/h5,7H,4H2,1-3H3 |
| InChIKey | HYAAVUKODRCMMV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1,3-dimethyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,3-dimethyl-2H-triazole?
The IUPAC name of 4-ethyl-1,3-dimethyl-2H-triazole (CID 91607569) is 4-ethyl-1,3-dimethyl-2H-triazole.
What is the SMILES notation for 4-ethyl-1,3-dimethyl-2H-triazole?
The canonical SMILES for 4-ethyl-1,3-dimethyl-2H-triazole is CCC1=CN(C)NN1C.
What is the InChIKey of 4-ethyl-1,3-dimethyl-2H-triazole?
The InChIKey is HYAAVUKODRCMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-4-6-5-8(2)7-9(6)3/h5,7H,4H2,1-3H3.
What are the key properties of 4-ethyl-1,3-dimethyl-2H-triazole?
4-ethyl-1,3-dimethyl-2H-triazole has a molecular weight of 127.19 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,3-dimethyl-2H-triazole is sourced from PubChem (CID 91607569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).