About 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile
5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile (PubChem CID 91607639) has the molecular formula C18H29NOS
and a molecular weight of 307.50 g/mol. Its IUPAC name is 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile.
Molecular Properties
| Compound Name | 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile |
| PubChem CID | 91607639 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile |
| SMILES | CC(C)C(C)(C)OCCCC(C#N)(c1cccs1)C(C)C |
| InChI | InChI=1S/C18H29NOS/c1-14(2)17(5,6)20-11-8-10-18(13-19,15(3)4)16-9-7-12-21-16/h7,9,12,14-15H,8,10-11H2,1-6H3 |
| InChIKey | DPTBVPXDCBRCOH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile?
The IUPAC name of 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile (CID 91607639) is 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile.
What is the SMILES notation for 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile?
The canonical SMILES for 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile is CC(C)C(C)(C)OCCCC(C#N)(c1cccs1)C(C)C.
What is the InChIKey of 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile?
The InChIKey is DPTBVPXDCBRCOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NOS/c1-14(2)17(5,6)20-11-8-10-18(13-19,15(3)4)16-9-7-12-21-16/h7,9,12,14-15H,8,10-11H2,1-6H3.
What are the key properties of 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile?
5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile has a molecular weight of 307.50 g/mol, XLogP of 5.40, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dimethylbutan-2-yloxy)-2-propan-2-yl-2-thiophen-2-ylpentanenitrile is sourced from PubChem (CID 91607639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).