About 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine
6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine (PubChem CID 91607957) has the molecular formula C17H28N4O2S
and a molecular weight of 352.50 g/mol. Its IUPAC name is 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 91607957 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1nc(N)c2nc(C(C)C)n(CCCCCS(C)(=O)=O)c2c1C |
| InChI | InChI=1S/C17H28N4O2S/c1-11(2)17-20-14-15(12(3)13(4)19-16(14)18)21(17)9-7-6-8-10-24(5,22)23/h11H,6-10H2,1-5H3,(H2,18,19) |
| InChIKey | REUGZYLMCUGBGS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine (CID 91607957) is 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine is Cc1nc(N)c2nc(C(C)C)n(CCCCCS(C)(=O)=O)c2c1C.
What is the InChIKey of 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
The InChIKey is REUGZYLMCUGBGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2S/c1-11(2)17-20-14-15(12(3)13(4)19-16(14)18)21(17)9-7-6-8-10-24(5,22)23/h11H,6-10H2,1-5H3,(H2,18,19).
What are the key properties of 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine has a molecular weight of 352.50 g/mol, XLogP of 2.97, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1-(5-methylsulfonylpentyl)-2-propan-2-ylimidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 91607957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).