About 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol
1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol (PubChem CID 91608007) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol |
| PubChem CID | 91608007 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol |
| SMILES | OCCc1c(CCO)c(O)n(Cc2ccccc2)c1O |
| InChI | InChI=1S/C15H19NO4/c17-8-6-12-13(7-9-18)15(20)16(14(12)19)10-11-4-2-1-3-5-11/h1-5,17-20H,6-10H2 |
| InChIKey | ZWQPGWGTHHWUBZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol?
The IUPAC name of 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol (CID 91608007) is 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol.
What is the SMILES notation for 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol?
The canonical SMILES for 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol is OCCc1c(CCO)c(O)n(Cc2ccccc2)c1O.
What is the InChIKey of 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol?
The InChIKey is ZWQPGWGTHHWUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4/c17-8-6-12-13(7-9-18)15(20)16(14(12)19)10-11-4-2-1-3-5-11/h1-5,17-20H,6-10H2.
What are the key properties of 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol?
1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol has a molecular weight of 277.32 g/mol, XLogP of 1.02, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,4-bis(2-hydroxyethyl)pyrrole-2,5-diol is sourced from PubChem (CID 91608007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).