C35H30FN5O4 — CID 91608054
tert-butyl N-[[4-[[dibenzofuran-4-yl(pyrimidin-4-yl)amino]-phenylcarbamoyl]-3-fluorophenyl]methyl]carbamate (PubChem CID 91608054) has the molecular formula C35H30FN5O4 and a molecular weight of 603.65 g/mol. Its IUPAC name is tert-butyl N-[[4-[[dibenzofuran-4-yl(pyrimidin-4-yl)amino]-phenylcarbamoyl]-3-fluorophenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[dibenzofuran-4-yl(pyrimidin-4-yl)amino]-phenylcarbamoyl]-3-fluorophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 91608054 |
| Molecular Formula | C35H30FN5O4 |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | tert-butyl N-[[4-[[dibenzofuran-4-yl(pyrimidin-4-yl)amino]-phenylcarbamoyl]-3-fluorophenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)N(c2ccccc2)N(c2ccncn2)c2cccc3c2oc2ccccc23)c(F)c1 |
| InChI | InChI=1S/C35H30FN5O4/c1-35(2,3)45-34(43)38-21-23-16-17-27(28(36)20-23)33(42)40(24-10-5-4-6-11-24)41(31-18-19-37-22-39-31)29-14-9-13-26-25-12-7-8-15-30(25)44-32(26)29/h4-20,22H,21H2,1-3H3,(H,38,43) |
| InChIKey | YRRRLDRLRCGEKP-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|