About 2-bromo-4-ethoxybutanal
2-bromo-4-ethoxybutanal (PubChem CID 91608133) has the molecular formula C6H11BrO2
and a molecular weight of 195.06 g/mol. Its IUPAC name is 2-bromo-4-ethoxybutanal.
Molecular Properties
| Compound Name | 2-bromo-4-ethoxybutanal |
| PubChem CID | 91608133 |
| Molecular Formula | C6H11BrO2 |
| Molecular Weight | 195.06 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | 2-bromo-4-ethoxybutanal |
| SMILES | CCOCCC(Br)C=O |
| InChI | InChI=1S/C6H11BrO2/c1-2-9-4-3-6(7)5-8/h5-6H,2-4H2,1H3 |
| InChIKey | HZSRELZEUHBPIH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-ethoxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-ethoxybutanal?
The IUPAC name of 2-bromo-4-ethoxybutanal (CID 91608133) is 2-bromo-4-ethoxybutanal.
What is the SMILES notation for 2-bromo-4-ethoxybutanal?
The canonical SMILES for 2-bromo-4-ethoxybutanal is CCOCCC(Br)C=O.
What is the InChIKey of 2-bromo-4-ethoxybutanal?
The InChIKey is HZSRELZEUHBPIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrO2/c1-2-9-4-3-6(7)5-8/h5-6H,2-4H2,1H3.
What are the key properties of 2-bromo-4-ethoxybutanal?
2-bromo-4-ethoxybutanal has a molecular weight of 195.06 g/mol, XLogP of 1.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-ethoxybutanal is sourced from PubChem (CID 91608133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).