C21H27N3O3 — CID 91608188
cyclohexylmethyl 6-(3-aminophenyl)-4-cyclopropyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 91608188) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is cyclohexylmethyl 6-(3-aminophenyl)-4-cyclopropyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 6-(3-aminophenyl)-4-cyclopropyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91608188 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | cyclohexylmethyl 6-(3-aminophenyl)-4-cyclopropyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | Nc1cccc(C2NC(=O)N=C(C3CC3)C2C(=O)OCC2CCCCC2)c1 |
| InChI | InChI=1S/C21H27N3O3/c22-16-8-4-7-15(11-16)19-17(18(14-9-10-14)23-21(26)24-19)20(25)27-12-13-5-2-1-3-6-13/h4,7-8,11,13-14,17,19H,1-3,5-6,9-10,12,22H2,(H,24,26) |
| InChIKey | CCPUUMZNQJNCLU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|