C25H22ClFN4O5S — CID 91608323
1-N-(4-chlorophenyl)-5-N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-3-formylpyrazolidine-1,5-dicarboxamide (PubChem CID 91608323) has the molecular formula C25H22ClFN4O5S and a molecular weight of 544.99 g/mol. Its IUPAC name is 1-N-(4-chlorophenyl)-5-N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-3-formylpyrazolidine-1,5-dicarboxamide.
| Compound Name | 1-N-(4-chlorophenyl)-5-N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-3-formylpyrazolidine-1,5-dicarboxamide |
|---|---|
| PubChem CID | 91608323 |
| Molecular Formula | C25H22ClFN4O5S |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 1-N-(4-chlorophenyl)-5-N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-3-formylpyrazolidine-1,5-dicarboxamide |
| SMILES | CS(=O)(=O)c1ccccc1-c1ccc(NC(=O)C2CC(C=O)NN2C(=O)Nc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C25H22ClFN4O5S/c1-37(35,36)23-5-3-2-4-19(23)15-6-11-21(20(27)12-15)29-24(33)22-13-18(14-32)30-31(22)25(34)28-17-9-7-16(26)8-10-17/h2-12,14,18,22,30H,13H2,1H3,(H,28,34)(H,29,33) |
| InChIKey | ZTQQDWRVQXPBQX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|