C23H26Cl2N6O7 — CID 91608669
ethyl (3R)-3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[3-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-2-oxo-3H-pyridine-5-carbonyl]amino]acetyl]amino]propanoate (PubChem CID 91608669) has the molecular formula C23H26Cl2N6O7 and a molecular weight of 569.40 g/mol. Its IUPAC name is ethyl (3R)-3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[3-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-2-oxo-3H-pyridine-5-carbonyl]amino]acetyl]amino]propanoate.
| Compound Name | ethyl (3R)-3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[3-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-2-oxo-3H-pyridine-5-carbonyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 91608669 |
| Molecular Formula | C23H26Cl2N6O7 |
| Molecular Weight | 569.40 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | ethyl (3R)-3-(3,5-dichloro-2-hydroxyphenyl)-3-[[2-[[3-[(5-hydroxy-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-2-oxo-3H-pyridine-5-carbonyl]amino]acetyl]amino]propanoate |
| SMILES | CCOC(=O)C[C@@H](NC(=O)CNC(=O)C1=CC(NC2=NCC(O)CN2)C(=O)N=C1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C23H26Cl2N6O7/c1-2-38-19(34)6-16(14-4-12(24)5-15(25)20(14)35)30-18(33)10-27-21(36)11-3-17(22(37)26-7-11)31-23-28-8-13(32)9-29-23/h3-5,7,13,16-17,32,35H,2,6,8-10H2,1H3,(H,27,36)(H,30,33)(H2,28,29,31)/t16-,17?/m1/s1 |
| InChIKey | MQQQZHWTYPSQKL-TZHYSIJRSA-N |
| XLogP | -0.26 |
| TPSA | 190.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|