C19H18N2O2 — CID 916087
1-(pyridin-4-ylmethyliminomethyl)-6,7,8,9-tetrahydrodibenzofuran-2-ol (PubChem CID 916087) has the molecular formula C19H18N2O2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyliminomethyl)-6,7,8,9-tetrahydrodibenzofuran-2-ol.
| Compound Name | 1-(pyridin-4-ylmethyliminomethyl)-6,7,8,9-tetrahydrodibenzofuran-2-ol |
|---|---|
| PubChem CID | 916087 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-(pyridin-4-ylmethyliminomethyl)-6,7,8,9-tetrahydrodibenzofuran-2-ol |
| SMILES | Oc1ccc2oc3c(c2c1/C=N/Cc1ccncc1)CCCC3 |
| InChI | InChI=1S/C19H18N2O2/c22-16-5-6-18-19(14-3-1-2-4-17(14)23-18)15(16)12-21-11-13-7-9-20-10-8-13/h5-10,12,22H,1-4,11H2/b21-12+ |
| InChIKey | DVBZTSCFPHABQS-CIAFOILYSA-N |
| XLogP | 4.03 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|