About 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate
2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate (PubChem CID 91608848) has the molecular formula C12H12Br2O2S2
and a molecular weight of 412.17 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate |
| PubChem CID | 91608848 |
| Molecular Formula | C12H12Br2O2S2 |
| Molecular Weight | 412.17 g/mol |
| Exact Mass | 409.86 |
| IUPAC Name | 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate |
| SMILES | CCC(C)(C)OC(=O)c1cc2c(Br)sc(Br)c2s1 |
| InChI | InChI=1S/C12H12Br2O2S2/c1-4-12(2,3)16-11(15)7-5-6-8(17-7)10(14)18-9(6)13/h5H,4H2,1-3H3 |
| InChIKey | UWRBTCYJTRPMJL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.17 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate (CID 91608848) is 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate is CCC(C)(C)OC(=O)c1cc2c(Br)sc(Br)c2s1.
What is the InChIKey of 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate?
The InChIKey is UWRBTCYJTRPMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Br2O2S2/c1-4-12(2,3)16-11(15)7-5-6-8(17-7)10(14)18-9(6)13/h5H,4H2,1-3H3.
What are the key properties of 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate?
2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate has a molecular weight of 412.17 g/mol, XLogP of 5.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 4,6-dibromothieno[2,3-c]thiophene-2-carboxylate is sourced from PubChem (CID 91608848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).