About 3-formyl-N,N,4-trimethylpentanamide
3-formyl-N,N,4-trimethylpentanamide (PubChem CID 91609262) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-formyl-N,N,4-trimethylpentanamide.
Molecular Properties
| Compound Name | 3-formyl-N,N,4-trimethylpentanamide |
| PubChem CID | 91609262 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-formyl-N,N,4-trimethylpentanamide |
| SMILES | CC(C)C(C=O)CC(=O)N(C)C |
| InChI | InChI=1S/C9H17NO2/c1-7(2)8(6-11)5-9(12)10(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | AJGQMUNCNKYVBR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-formyl-N,N,4-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formyl-N,N,4-trimethylpentanamide?
The IUPAC name of 3-formyl-N,N,4-trimethylpentanamide (CID 91609262) is 3-formyl-N,N,4-trimethylpentanamide.
What is the SMILES notation for 3-formyl-N,N,4-trimethylpentanamide?
The canonical SMILES for 3-formyl-N,N,4-trimethylpentanamide is CC(C)C(C=O)CC(=O)N(C)C.
What is the InChIKey of 3-formyl-N,N,4-trimethylpentanamide?
The InChIKey is AJGQMUNCNKYVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-7(2)8(6-11)5-9(12)10(3)4/h6-8H,5H2,1-4H3.
What are the key properties of 3-formyl-N,N,4-trimethylpentanamide?
3-formyl-N,N,4-trimethylpentanamide has a molecular weight of 171.24 g/mol, XLogP of 0.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formyl-N,N,4-trimethylpentanamide is sourced from PubChem (CID 91609262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).