C11H15Br — CID 91609327
1-bromo-2-ethyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 91609327) has the molecular formula C11H15Br and a molecular weight of 227.14 g/mol. Its IUPAC name is 1-bromo-2-ethyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-bromo-2-ethyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 91609327 |
| Molecular Formula | C11H15Br |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1-bromo-2-ethyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CCC1CC2C=CC=CC2C1Br |
| InChI | InChI=1S/C11H15Br/c1-2-8-7-9-5-3-4-6-10(9)11(8)12/h3-6,8-11H,2,7H2,1H3 |
| InChIKey | CZTRAKIXGIKKON-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|