C44H65ClO10 — CID 91609753
5-(chloromethyl)-1,2,3-trihexoxybenzene;methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-trimethylbenzoate (PubChem CID 91609753) has the molecular formula C44H65ClO10 and a molecular weight of 789.45 g/mol. Its IUPAC name is 5-(chloromethyl)-1,2,3-trihexoxybenzene;methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-trimethylbenzoate.
| Compound Name | 5-(chloromethyl)-1,2,3-trihexoxybenzene;methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-trimethylbenzoate |
|---|---|
| PubChem CID | 91609753 |
| Molecular Formula | C44H65ClO10 |
| Molecular Weight | 789.45 g/mol |
| Exact Mass | 788.43 |
| IUPAC Name | 5-(chloromethyl)-1,2,3-trihexoxybenzene;methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-trimethylbenzoate |
| SMILES | CCCCCCOc1cc(CCl)cc(OCCCCCC)c1OCCCCCC.COC(=O)c1cc(C)c(C)c(C)c1.COC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C25H43ClO3.C11H14O2.C8H8O5/c1-4-7-10-13-16-27-23-19-22(21-26)20-24(28-17-14-11-8-5-2)25(23)29-18-15-12-9-6-3;1-7-5-10(11(12)13-4)6-8(2)9(7)3;1-13-8(12)4-2-5(9)7(11)6(10)3-4/h19-20H,4-18,21H2,1-3H3;5-6H,1-4H3;2-3,9-11H,1H3 |
| InChIKey | CHFOUOXQYOLQPB-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.45 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|