About 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one
5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one (PubChem CID 91610083) has the molecular formula C24H22Cl2N4O
and a molecular weight of 453.37 g/mol. Its IUPAC name is 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one |
| PubChem CID | 91610083 |
| Molecular Formula | C24H22Cl2N4O |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one |
| SMILES | CN(C)c1ccc(-c2c(NCc3ccccc3)[nH]c(=O)n2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H22Cl2N4O/c1-29(2)18-10-8-17(9-11-18)22-23(27-15-16-6-4-3-5-7-16)28-24(31)30(22)19-12-13-20(25)21(26)14-19/h3-14,27H,15H2,1-2H3,(H,28,31) |
| InChIKey | QQWLPBSIOJKREP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one?
The IUPAC name of 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one (CID 91610083) is 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one.
What is the SMILES notation for 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one?
The canonical SMILES for 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one is CN(C)c1ccc(-c2c(NCc3ccccc3)[nH]c(=O)n2-c2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one?
The InChIKey is QQWLPBSIOJKREP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N4O/c1-29(2)18-10-8-17(9-11-18)22-23(27-15-16-6-4-3-5-7-16)28-24(31)30(22)19-12-13-20(25)21(26)14-19/h3-14,27H,15H2,1-2H3,(H,28,31).
What are the key properties of 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one?
5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one has a molecular weight of 453.37 g/mol, XLogP of 5.82, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzylamino)-3-(3,4-dichlorophenyl)-4-[4-(dimethylamino)phenyl]-1H-imidazol-2-one is sourced from PubChem (CID 91610083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).