C16H17F6NO6S — CID 91610113
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,1,2,3,3-hexafluoro-3-[(2-methylpropan-2-yl)oxy]propane-2-sulfonate (PubChem CID 91610113) has the molecular formula C16H17F6NO6S and a molecular weight of 465.37 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,1,2,3,3-hexafluoro-3-[(2-methylpropan-2-yl)oxy]propane-2-sulfonate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,1,2,3,3-hexafluoro-3-[(2-methylpropan-2-yl)oxy]propane-2-sulfonate |
|---|---|
| PubChem CID | 91610113 |
| Molecular Formula | C16H17F6NO6S |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 1,1,1,2,3,3-hexafluoro-3-[(2-methylpropan-2-yl)oxy]propane-2-sulfonate |
| SMILES | CC(C)(C)OC(F)(F)C(F)(C(F)(F)F)S(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C16H17F6NO6S/c1-13(2,3)28-16(21,22)14(17,15(18,19)20)30(26,27)29-23-11(24)9-7-4-5-8(6-7)10(9)12(23)25/h4-5,7-8,24-25H,6H2,1-3H3 |
| InChIKey | QBMRVRAUNJXIMA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|