C23H27F3N4 — CID 91610139
4-phenyl-3-(2-piperidin-4-ylethyl)-7-(trifluoromethyl)-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene (PubChem CID 91610139) has the molecular formula C23H27F3N4 and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-phenyl-3-(2-piperidin-4-ylethyl)-7-(trifluoromethyl)-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene.
| Compound Name | 4-phenyl-3-(2-piperidin-4-ylethyl)-7-(trifluoromethyl)-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene |
|---|---|
| PubChem CID | 91610139 |
| Molecular Formula | C23H27F3N4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 4-phenyl-3-(2-piperidin-4-ylethyl)-7-(trifluoromethyl)-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-triene |
| SMILES | FC(F)(F)C1N=C2CCCC2c2c1nc(-c1ccccc1)n2CCC1CCNCC1 |
| InChI | InChI=1S/C23H27F3N4/c24-23(25,26)21-19-20(17-7-4-8-18(17)28-21)30(14-11-15-9-12-27-13-10-15)22(29-19)16-5-2-1-3-6-16/h1-3,5-6,15,17,21,27H,4,7-14H2 |
| InChIKey | GICOKGXGUHDXTB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |