About acetaldehyde;methanamine;1-methyliminopropan-2-one
acetaldehyde;methanamine;1-methyliminopropan-2-one (PubChem CID 91610156) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is acetaldehyde;methanamine;1-methyliminopropan-2-one.
Molecular Properties
| Compound Name | acetaldehyde;methanamine;1-methyliminopropan-2-one |
| PubChem CID | 91610156 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | acetaldehyde;methanamine;1-methyliminopropan-2-one |
| SMILES | C/N=C/C(C)=O.CC=O.CN |
| InChI | InChI=1S/C4H7NO.C2H4O.CH5N/c1-4(6)3-5-2;1-2-3;1-2/h3H,1-2H3;2H,1H3;2H2,1H3/b5-3+;; |
| InChIKey | XIVUGDCCBVLSKD-RQCPZROWSA-N |
| XLogP | 0.06 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;methanamine;1-methyliminopropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;methanamine;1-methyliminopropan-2-one?
The IUPAC name of acetaldehyde;methanamine;1-methyliminopropan-2-one (CID 91610156) is acetaldehyde;methanamine;1-methyliminopropan-2-one.
What is the SMILES notation for acetaldehyde;methanamine;1-methyliminopropan-2-one?
The canonical SMILES for acetaldehyde;methanamine;1-methyliminopropan-2-one is C/N=C/C(C)=O.CC=O.CN.
What is the InChIKey of acetaldehyde;methanamine;1-methyliminopropan-2-one?
The InChIKey is XIVUGDCCBVLSKD-RQCPZROWSA-N. The full InChI is InChI=1S/C4H7NO.C2H4O.CH5N/c1-4(6)3-5-2;1-2-3;1-2/h3H,1-2H3;2H,1H3;2H2,1H3/b5-3+;;.
What are the key properties of acetaldehyde;methanamine;1-methyliminopropan-2-one?
acetaldehyde;methanamine;1-methyliminopropan-2-one has a molecular weight of 160.22 g/mol, XLogP of 0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;methanamine;1-methyliminopropan-2-one is sourced from PubChem (CID 91610156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).