C26H40O4 — CID 91610674
4-hydroxy-2,3-dimethoxy-6-methyl-5-(2,5,7,7,10-pentamethylundeca-4,9-dien-2-yl)benzaldehyde (PubChem CID 91610674) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethoxy-6-methyl-5-(2,5,7,7,10-pentamethylundeca-4,9-dien-2-yl)benzaldehyde.
| Compound Name | 4-hydroxy-2,3-dimethoxy-6-methyl-5-(2,5,7,7,10-pentamethylundeca-4,9-dien-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 91610674 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 4-hydroxy-2,3-dimethoxy-6-methyl-5-(2,5,7,7,10-pentamethylundeca-4,9-dien-2-yl)benzaldehyde |
| SMILES | COc1c(O)c(C(C)(C)CC=C(C)CC(C)(C)CC=C(C)C)c(C)c(C=O)c1OC |
| InChI | InChI=1S/C26H40O4/c1-17(2)11-13-25(5,6)15-18(3)12-14-26(7,8)21-19(4)20(16-27)23(29-9)24(30-10)22(21)28/h11-12,16,28H,13-15H2,1-10H3 |
| InChIKey | OLQYYQCQXXFZCS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|