C35H41NO6S2 — CID 91610694
N-[5-tert-butyl-3-[6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl]benzenesulfonamide (PubChem CID 91610694) has the molecular formula C35H41NO6S2 and a molecular weight of 635.85 g/mol. Its IUPAC name is N-[5-tert-butyl-3-[6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl]benzenesulfonamide.
| Compound Name | N-[5-tert-butyl-3-[6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91610694 |
| Molecular Formula | C35H41NO6S2 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | N-[5-tert-butyl-3-[6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl]benzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccccc2)cc(C(C)(C)C)cc1SC1C(=O)CC(CCc2ccc(O)cc2)(C2CCCC2)OC1=O |
| InChI | InChI=1S/C35H41NO6S2/c1-23-29(36-44(40,41)28-12-6-5-7-13-28)20-26(34(2,3)4)21-31(23)43-32-30(38)22-35(42-33(32)39,25-10-8-9-11-25)19-18-24-14-16-27(37)17-15-24/h5-7,12-17,20-21,25,32,36-37H,8-11,18-19,22H2,1-4H3 |
| InChIKey | VXEDEHPJJBAZIW-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|