C28H41NO4Si — CID 91611041
tert-butyl (2R,3R)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxypyrrolidine-1-carboxylate (PubChem CID 91611041) has the molecular formula C28H41NO4Si and a molecular weight of 483.73 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91611041 |
| Molecular Formula | C28H41NO4Si |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | tert-butyl (2R,3R)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](O)[C@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H41NO4Si/c1-27(2,3)33-26(31)29-20-19-25(30)24(29)18-13-21-32-34(28(4,5)6,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17,24-25,30H,13,18-21H2,1-6H3/t24-,25-/m1/s1 |
| InChIKey | OEXZZUFUMVLIES-JWQCQUIFSA-N |
| XLogP | 4.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|