C20H32O — CID 91611480
5-(2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalen-1-yl)-3-methylpent-1-en-3-ol (PubChem CID 91611480) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 5-(2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalen-1-yl)-3-methylpent-1-en-3-ol.
| Compound Name | 5-(2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalen-1-yl)-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 91611480 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 5-(2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalen-1-yl)-3-methylpent-1-en-3-ol |
| SMILES | C=CC(C)(O)CCC1C(C)=CC=C2C(C)(C)CCCC21C |
| InChI | InChI=1S/C20H32O/c1-7-19(5,21)14-11-16-15(2)9-10-17-18(3,4)12-8-13-20(16,17)6/h7,9-10,16,21H,1,8,11-14H2,2-6H3 |
| InChIKey | XQDZQHHHNWNIAR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|