C24H30N4O3 — CID 91611670
3-[4-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]pyridin-3-yl]-1-methoxyprop-2-en-1-ol (PubChem CID 91611670) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-[4-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]pyridin-3-yl]-1-methoxyprop-2-en-1-ol.
| Compound Name | 3-[4-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]pyridin-3-yl]-1-methoxyprop-2-en-1-ol |
|---|---|
| PubChem CID | 91611670 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 3-[4-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-c]pyridin-3-yl]-1-methoxyprop-2-en-1-ol |
| SMILES | COc1ccc(Cn2nc(C=CC(O)OC)c3c(NC4CCCCC4)nccc32)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-30-19-10-8-17(9-11-19)16-28-21-14-15-25-24(26-18-6-4-3-5-7-18)23(21)20(27-28)12-13-22(29)31-2/h8-15,18,22,29H,3-7,16H2,1-2H3,(H,25,26) |
| InChIKey | PFBUDHNTTIFNRF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|