C6H10Cl2F2S2 — CID 91611785
3-(2,3-dichloropropylsulfanyl)-2,3-difluoropropane-1-thiol (PubChem CID 91611785) has the molecular formula C6H10Cl2F2S2 and a molecular weight of 255.18 g/mol. Its IUPAC name is 3-(2,3-dichloropropylsulfanyl)-2,3-difluoropropane-1-thiol.
| Compound Name | 3-(2,3-dichloropropylsulfanyl)-2,3-difluoropropane-1-thiol |
|---|---|
| PubChem CID | 91611785 |
| Molecular Formula | C6H10Cl2F2S2 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 3-(2,3-dichloropropylsulfanyl)-2,3-difluoropropane-1-thiol |
| SMILES | FC(CS)C(F)SCC(Cl)CCl |
| InChI | InChI=1S/C6H10Cl2F2S2/c7-1-4(8)3-12-6(10)5(9)2-11/h4-6,11H,1-3H2 |
| InChIKey | NCAQDOMFCUTHCV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|