About 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene
6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene (PubChem CID 91611900) has the molecular formula C10H13FO2
and a molecular weight of 184.21 g/mol. Its IUPAC name is 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene |
| PubChem CID | 91611900 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene |
| SMILES | C=CC1C(OC)=CC(F)=CC1OC |
| InChI | InChI=1S/C10H13FO2/c1-4-8-9(12-2)5-7(11)6-10(8)13-3/h4-6,8-9H,1H2,2-3H3 |
| InChIKey | XZWPGMXHHYCWDX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene?
The IUPAC name of 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene (CID 91611900) is 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene.
What is the SMILES notation for 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene?
The canonical SMILES for 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene is C=CC1C(OC)=CC(F)=CC1OC.
What is the InChIKey of 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene?
The InChIKey is XZWPGMXHHYCWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO2/c1-4-8-9(12-2)5-7(11)6-10(8)13-3/h4-6,8-9H,1H2,2-3H3.
What are the key properties of 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene?
6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene has a molecular weight of 184.21 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-3-fluoro-1,5-dimethoxycyclohexa-1,3-diene is sourced from PubChem (CID 91611900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).