About 6,7-dimethyloct-5-en-2-yne
6,7-dimethyloct-5-en-2-yne (PubChem CID 91612504) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is 6,7-dimethyloct-5-en-2-yne.
Molecular Properties
| Compound Name | 6,7-dimethyloct-5-en-2-yne |
| PubChem CID | 91612504 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 6,7-dimethyloct-5-en-2-yne |
| SMILES | CC#CCC=C(C)C(C)C |
| InChI | InChI=1S/C10H16/c1-5-6-7-8-10(4)9(2)3/h8-9H,7H2,1-4H3 |
| InChIKey | LLHVCZLFMGNDFK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethyloct-5-en-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyloct-5-en-2-yne?
The IUPAC name of 6,7-dimethyloct-5-en-2-yne (CID 91612504) is 6,7-dimethyloct-5-en-2-yne.
What is the SMILES notation for 6,7-dimethyloct-5-en-2-yne?
The canonical SMILES for 6,7-dimethyloct-5-en-2-yne is CC#CCC=C(C)C(C)C.
What is the InChIKey of 6,7-dimethyloct-5-en-2-yne?
The InChIKey is LLHVCZLFMGNDFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-5-6-7-8-10(4)9(2)3/h8-9H,7H2,1-4H3.
What are the key properties of 6,7-dimethyloct-5-en-2-yne?
6,7-dimethyloct-5-en-2-yne has a molecular weight of 136.24 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyloct-5-en-2-yne is sourced from PubChem (CID 91612504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).