C19H24ClN3O — CID 9161262
(2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2-methoxyphenyl)ethanamine (PubChem CID 9161262) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is (2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2-methoxyphenyl)ethanamine.
| Compound Name | (2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 9161262 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2-methoxyphenyl)ethanamine |
| SMILES | COc1ccccc1[C@@H](CN)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H24ClN3O/c1-24-19-8-3-2-7-17(19)18(14-21)23-11-9-22(10-12-23)16-6-4-5-15(20)13-16/h2-8,13,18H,9-12,14,21H2,1H3/t18-/m1/s1 |
| InChIKey | VQBACUCSRATCEB-GOSISDBHSA-N |
| XLogP | 3.17 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |