About 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one
5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one (PubChem CID 91612728) has the molecular formula C7H11N4O2+
and a molecular weight of 183.19 g/mol. Its IUPAC name is 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one |
| PubChem CID | 91612728 |
| Molecular Formula | C7H11N4O2+ |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one |
| SMILES | C[N+]1(C2=NC(=O)N=N2)CCOCC1 |
| InChI | InChI=1S/C7H11N4O2/c1-11(2-4-13-5-3-11)6-8-7(12)10-9-6/h2-5H2,1H3/q+1 |
| InChIKey | LDBMSVOUVKEAMT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one?
The IUPAC name of 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one (CID 91612728) is 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one.
What is the SMILES notation for 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one?
The canonical SMILES for 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one is C[N+]1(C2=NC(=O)N=N2)CCOCC1.
What is the InChIKey of 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one?
The InChIKey is LDBMSVOUVKEAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N4O2/c1-11(2-4-13-5-3-11)6-8-7(12)10-9-6/h2-5H2,1H3/q+1.
What are the key properties of 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one?
5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one has a molecular weight of 183.19 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylmorpholin-4-ium-4-yl)-1,2,4-triazol-3-one is sourced from PubChem (CID 91612728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).