C10H12O — CID 91613225
(3aR,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carbaldehyde (PubChem CID 91613225) has the molecular formula C10H12O and a molecular weight of 148.21 g/mol. Its IUPAC name is (3aR,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carbaldehyde.
| Compound Name | (3aR,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carbaldehyde |
|---|---|
| PubChem CID | 91613225 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (3aR,7aR)-2,3,3a,7a-tetrahydro-1H-indene-4-carbaldehyde |
| SMILES | O=CC1=CC=C[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C10H12O/c11-7-9-5-1-3-8-4-2-6-10(8)9/h1,3,5,7-8,10H,2,4,6H2/t8-,10+/m0/s1 |
| InChIKey | NRPGDWVRKOJMEE-WCBMZHEXSA-N |
| XLogP | 2.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|