C21H29NO3 — CID 91613817
[1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 91613817) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is [1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-prop-2-enylpiperidin-3-yl]methanol.
| Compound Name | [1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-prop-2-enylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 91613817 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CCC1(CO)CCCN(C(CC2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C21H29NO3/c1-2-9-21(17-23)10-6-11-22(16-21)19(20-15-24-12-13-25-20)14-18-7-4-3-5-8-18/h2-4,7,12-13,15,19,23H,1,5-6,8-11,14,16-17H2 |
| InChIKey | AQLKLALGCHWDQZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|