C42H69O8P — CID 91614039
2,5-dimethylbenzene-1,4-diol;dioctyl 5-methylbenzene-1,3-dicarboxylate;3,5,5-trimethyl-1-phosphorosooxyhexane (PubChem CID 91614039) has the molecular formula C42H69O8P and a molecular weight of 732.98 g/mol. Its IUPAC name is 2,5-dimethylbenzene-1,4-diol;dioctyl 5-methylbenzene-1,3-dicarboxylate;3,5,5-trimethyl-1-phosphorosooxyhexane.
| Compound Name | 2,5-dimethylbenzene-1,4-diol;dioctyl 5-methylbenzene-1,3-dicarboxylate;3,5,5-trimethyl-1-phosphorosooxyhexane |
|---|---|
| PubChem CID | 91614039 |
| Molecular Formula | C42H69O8P |
| Molecular Weight | 732.98 g/mol |
| Exact Mass | 732.47 |
| IUPAC Name | 2,5-dimethylbenzene-1,4-diol;dioctyl 5-methylbenzene-1,3-dicarboxylate;3,5,5-trimethyl-1-phosphorosooxyhexane |
| SMILES | CC(CCOP=O)CC(C)(C)C.CCCCCCCCOC(=O)c1cc(C)cc(C(=O)OCCCCCCCC)c1.Cc1cc(O)c(C)cc1O |
| InChI | InChI=1S/C25H40O4.C9H19O2P.C8H10O2/c1-4-6-8-10-12-14-16-28-24(26)22-18-21(3)19-23(20-22)25(27)29-17-15-13-11-9-7-5-2;1-8(5-6-11-12-10)7-9(2,3)4;1-5-3-8(10)6(2)4-7(5)9/h18-20H,4-17H2,1-3H3;8H,5-7H2,1-4H3;3-4,9-10H,1-2H3 |
| InChIKey | VSHXBAKXRGHVON-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.98 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|