About 2,4-bis(trifluoromethyl)-1,3,5-triazine
2,4-bis(trifluoromethyl)-1,3,5-triazine (PubChem CID 91614506) has the molecular formula C5HF6N3
and a molecular weight of 217.07 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-bis(trifluoromethyl)-1,3,5-triazine |
| PubChem CID | 91614506 |
| Molecular Formula | C5HF6N3 |
| Molecular Weight | 217.07 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 2,4-bis(trifluoromethyl)-1,3,5-triazine |
| SMILES | FC(F)(F)c1ncnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C5HF6N3/c6-4(7,8)2-12-1-13-3(14-2)5(9,10)11/h1H |
| InChIKey | AIQLUHQAIICRTI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.07 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis(trifluoromethyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(trifluoromethyl)-1,3,5-triazine?
The IUPAC name of 2,4-bis(trifluoromethyl)-1,3,5-triazine (CID 91614506) is 2,4-bis(trifluoromethyl)-1,3,5-triazine.
What is the SMILES notation for 2,4-bis(trifluoromethyl)-1,3,5-triazine?
The canonical SMILES for 2,4-bis(trifluoromethyl)-1,3,5-triazine is FC(F)(F)c1ncnc(C(F)(F)F)n1.
What is the InChIKey of 2,4-bis(trifluoromethyl)-1,3,5-triazine?
The InChIKey is AIQLUHQAIICRTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HF6N3/c6-4(7,8)2-12-1-13-3(14-2)5(9,10)11/h1H.
What are the key properties of 2,4-bis(trifluoromethyl)-1,3,5-triazine?
2,4-bis(trifluoromethyl)-1,3,5-triazine has a molecular weight of 217.07 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(trifluoromethyl)-1,3,5-triazine is sourced from PubChem (CID 91614506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).