About (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol
(2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol (PubChem CID 91614591) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol |
| PubChem CID | 91614591 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol |
| SMILES | CCCOc1nc(C)sc1CO |
| InChI | InChI=1S/C8H13NO2S/c1-3-4-11-8-7(5-10)12-6(2)9-8/h10H,3-5H2,1-2H3 |
| InChIKey | IHHUZNHQTIOHMF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol?
The IUPAC name of (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol (CID 91614591) is (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol.
What is the SMILES notation for (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol?
The canonical SMILES for (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol is CCCOc1nc(C)sc1CO.
What is the InChIKey of (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol?
The InChIKey is IHHUZNHQTIOHMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-3-4-11-8-7(5-10)12-6(2)9-8/h10H,3-5H2,1-2H3.
What are the key properties of (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol?
(2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol has a molecular weight of 187.26 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-propoxy-1,3-thiazol-5-yl)methanol is sourced from PubChem (CID 91614591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).