About 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine
2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine (PubChem CID 91615258) has the molecular formula C6H10FN
and a molecular weight of 115.15 g/mol. Its IUPAC name is 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine.
Molecular Properties
| Compound Name | 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine |
| PubChem CID | 91615258 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine |
| SMILES | CC1=NC(F)CCC1 |
| InChI | InChI=1S/C6H10FN/c1-5-3-2-4-6(7)8-5/h6H,2-4H2,1H3 |
| InChIKey | OWSDBHCMEDGCRT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine?
The IUPAC name of 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine (CID 91615258) is 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine is CC1=NC(F)CCC1.
What is the InChIKey of 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine?
The InChIKey is OWSDBHCMEDGCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FN/c1-5-3-2-4-6(7)8-5/h6H,2-4H2,1H3.
What are the key properties of 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine?
2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine has a molecular weight of 115.15 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-methyl-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 91615258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).