C32H30Cl2N10O14S4-2 — CID 91615594
7-[[(2E)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 91615594) has the molecular formula C32H30Cl2N10O14S4-2 and a molecular weight of 977.82 g/mol. Its IUPAC name is 7-[[(2E)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 7-[[(2E)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 91615594 |
| Molecular Formula | C32H30Cl2N10O14S4-2 |
| Molecular Weight | 977.82 g/mol |
| Exact Mass | 976.02 |
| IUPAC Name | 7-[[(2E)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCC1=C(C(=O)[O-])N2C(=O)C(NC(=O)/C(=N/OCC(=O)O)c3nc(N)sc3Cl)C2SC1.CCC1=C(C(=O)[O-])N2C(=O)C(NC(=O)/C(=N/OCC(=O)O)c3nc(N)sc3Cl)C2SC1 |
| InChI | InChI=1S/2C16H16ClN5O7S2/c2*1-2-5-4-30-14-9(13(26)22(14)10(5)15(27)28)19-12(25)8(21-29-3-6(23)24)7-11(17)31-16(18)20-7/h2*9,14H,2-4H2,1H3,(H2,18,20)(H,19,25)(H,23,24)(H,27,28)/p-2/b2*21-8+ |
| InChIKey | CDNVGZDZTGZXKE-NLGDEQGTSA-L |
| XLogP | -2.00 |
| TPSA | 374.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.82 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|