C6H2ClF9 — CID 91616290
1-chloro-3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene (PubChem CID 91616290) has the molecular formula C6H2ClF9 and a molecular weight of 280.52 g/mol. Its IUPAC name is 1-chloro-3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene.
| Compound Name | 1-chloro-3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene |
|---|---|
| PubChem CID | 91616290 |
| Molecular Formula | C6H2ClF9 |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 1-chloro-3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C=CCl |
| InChI | InChI=1S/C6H2ClF9/c7-2-1-3(8,9)4(10,11)5(12,13)6(14,15)16/h1-2H |
| InChIKey | ZRUPOJGEYFUDHB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|