C14H18F6O3 — CID 91617013
2-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexyl]methyl]prop-2-enoic acid (PubChem CID 91617013) has the molecular formula C14H18F6O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 2-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexyl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexyl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91617013 |
| Molecular Formula | C14H18F6O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexyl]methyl]prop-2-enoic acid |
| SMILES | C=C(CC1(C)CCCCC1C(O)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H18F6O3/c1-8(10(21)22)7-11(2)6-4-3-5-9(11)12(23,13(15,16)17)14(18,19)20/h9,23H,1,3-7H2,2H3,(H,21,22) |
| InChIKey | DZRACUIEEOPLRO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|