C10H16 — CID 91618084
(1R,3R,6R,8R)-tricyclo[4.4.0.03,8]decane (PubChem CID 91618084) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (1R,3R,6R,8R)-tricyclo[4.4.0.03,8]decane.
| Compound Name | (1R,3R,6R,8R)-tricyclo[4.4.0.03,8]decane |
|---|---|
| PubChem CID | 91618084 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (1R,3R,6R,8R)-tricyclo[4.4.0.03,8]decane |
| SMILES | C1C[C@@H]2C[C@H]3CC[C@@H]2C[C@@H]13 |
| InChI | InChI=1S/C10H16/c1-2-8-6-9-3-4-10(8)5-7(1)9/h7-10H,1-6H2/t7-,8-,9-,10-/m1/s1 |
| InChIKey | AEVSQVUUXPSWPL-ZYUZMQFOSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |