About 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile
2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile (PubChem CID 91618403) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile |
| PubChem CID | 91618403 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile |
| SMILES | CCc1noc(CC#N)n1 |
| InChI | InChI=1S/C6H7N3O/c1-2-5-8-6(3-4-7)10-9-5/h2-3H2,1H3 |
| InChIKey | CHSLJOCABAWFJZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile?
The IUPAC name of 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile (CID 91618403) is 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile.
What is the SMILES notation for 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile?
The canonical SMILES for 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile is CCc1noc(CC#N)n1.
What is the InChIKey of 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile?
The InChIKey is CHSLJOCABAWFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c1-2-5-8-6(3-4-7)10-9-5/h2-3H2,1H3.
What are the key properties of 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile?
2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile has a molecular weight of 137.14 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetonitrile is sourced from PubChem (CID 91618403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).