C9H19N3O — CID 91618734
1,1-dimethyl-3-(1-methylpiperidin-3-yl)urea (PubChem CID 91618734) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 1,1-dimethyl-3-(1-methylpiperidin-3-yl)urea.
| Compound Name | 1,1-dimethyl-3-(1-methylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 91618734 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1,1-dimethyl-3-(1-methylpiperidin-3-yl)urea |
| SMILES | CN1CCCC(NC(=O)N(C)C)C1 |
| InChI | InChI=1S/C9H19N3O/c1-11(2)9(13)10-8-5-4-6-12(3)7-8/h8H,4-7H2,1-3H3,(H,10,13) |
| InChIKey | XDYGYQPYYHZCCN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |