About 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one
7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 91618987) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| PubChem CID | 91618987 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | O=C1CNc2ncc(C3CC3)cc2N1 |
| InChI | InChI=1S/C10H11N3O/c14-9-5-12-10-8(13-9)3-7(4-11-10)6-1-2-6/h3-4,6H,1-2,5H2,(H,11,12)(H,13,14) |
| InChIKey | LTTOCDLATFJRJA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The IUPAC name of 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (CID 91618987) is 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
What is the SMILES notation for 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The canonical SMILES for 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one is O=C1CNc2ncc(C3CC3)cc2N1.
What is the InChIKey of 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
The InChIKey is LTTOCDLATFJRJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c14-9-5-12-10-8(13-9)3-7(4-11-10)6-1-2-6/h3-4,6H,1-2,5H2,(H,11,12)(H,13,14).
What are the key properties of 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one?
7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one has a molecular weight of 189.22 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one is sourced from PubChem (CID 91618987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).