About 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride
7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride (PubChem CID 91619175) has the molecular formula C7H4Cl2N2O2S
and a molecular weight of 251.09 g/mol. Its IUPAC name is 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride |
| PubChem CID | 91619175 |
| Molecular Formula | C7H4Cl2N2O2S |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 249.94 |
| IUPAC Name | 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c[nH]c2c(Cl)nccc12 |
| InChI | InChI=1S/C7H4Cl2N2O2S/c8-7-6-4(1-2-10-7)5(3-11-6)14(9,12)13/h1-3,11H |
| InChIKey | LFPUMWIBPJUSOA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride?
The IUPAC name of 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride (CID 91619175) is 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride.
What is the SMILES notation for 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride?
The canonical SMILES for 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride is O=S(=O)(Cl)c1c[nH]c2c(Cl)nccc12.
What is the InChIKey of 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride?
The InChIKey is LFPUMWIBPJUSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2N2O2S/c8-7-6-4(1-2-10-7)5(3-11-6)14(9,12)13/h1-3,11H.
What are the key properties of 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride?
7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride has a molecular weight of 251.09 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1H-pyrrolo[2,3-c]pyridine-3-sulfonyl chloride is sourced from PubChem (CID 91619175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).